CAS 1523618-36-1 appears in our catalog under these names: tert-Butyl 1,8-diazaspiro(4.5)decane-8-carboxylate oxalate(2:1), 97%, tert–Butyl 1，8–diazaspiro(4·5)decane–8–carboxylate oxalate(2：1), tert-Butyl 1,8-diazaspiro[4.5]decane-8-carboxylate oxalate(2:1), 95%, 95%. Offered by: AmBeed, GLPBio, Chemat. Available pack sizes: 25g, 10g, 100mg, 1g, 250mg, 5g.
Bis(tert-butyl 1,8-diazaspiro[4.5]decane-8-carboxylate);oxalic acid (CAS 1523618-36-1) is a chemical compound with the molecular formula C28H50N4O8 and a molecular weight of 570.7 g/mol. IUPAC name: bis(tert-butyl 1,8-diazaspiro[4.5]decane-8-carboxylate);oxalic acid. InChIKey: BGFMXHGODSWFMS-UHFFFAOYSA-N.
| Molecular formula | C28H50N4O8 |
|---|---|
| Molecular weight | 570.7 g/mol |
| IUPAC name | bis(tert-butyl 1,8-diazaspiro[4.5]decane-8-carboxylate);oxalic acid |
| InChIKey | BGFMXHGODSWFMS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCN2)CC1.CC(C)(C)OC(=O)N1CCC2(CCCN2)CC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)