Products 2940953-52-4

CAS 2940953-52-4 appears in our catalog under these names: tert-Butyl 1,7-diazaspiro(3.6)decane-7-carboxylate hemioxalate, 98%, tert-butyl 1,8-diazaspiro[3.6]decane-8-carboxylate,hemi(oxalic acid), 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.

Bis(tert-butyl 1,8-diazaspiro[3.6]decane-8-carboxylate);oxalic acid (CAS 2940953-52-4) is a chemical compound with the molecular formula C28H50N4O8 and a molecular weight of 570.7 g/mol. IUPAC name: bis(tert-butyl 1,8-diazaspiro[3.6]decane-8-carboxylate);oxalic acid. InChIKey: XUTXPMAWBPLTLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC28H50N4O8
Molecular weight570.7 g/mol
IUPAC namebis(tert-butyl 1,8-diazaspiro[3.6]decane-8-carboxylate);oxalic acid
InChIKeyXUTXPMAWBPLTLJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC2(CCN2)CC1.CC(C)(C)OC(=O)N1CCCC2(CCN2)CC1.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)