Products 1630907-08-2

CAS 1630907-08-2 appears in our catalog under these names: tert-Butyl 2,6-diazaspiro[4.5]decane-6-carboxylate hemioxalate, 95%, tert-Butyl 2,6-diazaspiro(4.5)decane-6-carboxylate oxalate(2:1), 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.

Bis(tert-butyl 2,6-diazaspiro[4.5]decane-6-carboxylate);oxalic acid (CAS 1630907-08-2) is a chemical compound with the molecular formula C28H50N4O8 and a molecular weight of 570.7 g/mol. IUPAC name: bis(tert-butyl 2,6-diazaspiro[4.5]decane-6-carboxylate);oxalic acid. InChIKey: QMWAZGQMSXUQPA-UHFFFAOYSA-N.

Identity
Molecular formulaC28H50N4O8
Molecular weight570.7 g/mol
IUPAC namebis(tert-butyl 2,6-diazaspiro[4.5]decane-6-carboxylate);oxalic acid
InChIKeyQMWAZGQMSXUQPA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCCC12CCNC2.CC(C)(C)OC(=O)N1CCCCC12CCNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)