Products 15251-47-5

CAS 15251-47-5 is the registry number for Anabasine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 50mg, 5mg, 10g, 5g, 25g.

Structural formula: {0} (CAS {1})

3-[(2S)-piperidin-2-yl]pyridine;hydrochloride (CAS 15251-47-5) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: 3-[(2S)-piperidin-2-yl]pyridine;hydrochloride. InChIKey: VTMZQNZVYCJLGG-PPHPATTJSA-N.

Identity
Molecular formulaC10H15ClN2
Molecular weight198.69 g/mol
IUPAC name3-[(2S)-piperidin-2-yl]pyridine;hydrochloride
InChIKeyVTMZQNZVYCJLGG-PPHPATTJSA-N
SMILESC1CCN[C@@H](C1)C2=CN=CC=C2.Cl

Computed by PubChem (NCBI)