CAS 152521-02-3 is the registry number for Travoprost Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.
[(3aR,4R,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (CAS 152521-02-3) is a chemical compound with the molecular formula C21H20O5 and a molecular weight of 352.4 g/mol. IUPAC name: [(3aR,4R,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate. InChIKey: SZJVIFMPKWMGSX-YDZRNGNQSA-N.
| Molecular formula | C21H20O5 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | [(3aR,4R,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| InChIKey | SZJVIFMPKWMGSX-YDZRNGNQSA-N |
| SMILES | C1[C@H]2[C@H](CC(=O)O2)[C@@H]([C@@H]1OC(=O)C3=CC=C(C=C3)C4=CC=CC=C4)CO |
Computed by PubChem (NCBI)