CAS 39265-57-1 appears in our catalog under these names: (+)-Corey Lactone, >95% (HPLC), (+)-Corey Lactone, ≥98%, ≥98%. Offered by: TRC, Chemat. Available pack sizes: 10g, 1g, 100mg, 250mg, 5g, 25g.
[(3aS,4R,5S,6aR)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (CAS 39265-57-1) is a chemical compound with the molecular formula C21H20O5 and a molecular weight of 352.4 g/mol. IUPAC name: [(3aS,4R,5S,6aR)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate. InChIKey: SZJVIFMPKWMGSX-OKYOBFRVSA-N.
| Molecular formula | C21H20O5 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | [(3aS,4R,5S,6aR)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| InChIKey | SZJVIFMPKWMGSX-OKYOBFRVSA-N |
| SMILES | C1[C@@H]2[C@@H](CC(=O)O2)[C@@H]([C@H]1OC(=O)C3=CC=C(C=C3)C4=CC=CC=C4)CO |
Computed by PubChem (NCBI)