CAS 428845-94-7 is the registry number for 2-[(3-Benzyl-4,7-dimethyl-2-oxo-2h-chromen-5-yl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxypropanoic acid (CAS 428845-94-7) is a chemical compound with the molecular formula C21H20O5 and a molecular weight of 352.4 g/mol. IUPAC name: 2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxypropanoic acid. InChIKey: ZOUCUTUYRHWVDD-UHFFFAOYSA-N.
| Molecular formula | C21H20O5 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 2-(3-benzyl-4,7-dimethyl-2-oxochromen-5-yl)oxypropanoic acid |
| InChIKey | ZOUCUTUYRHWVDD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C(C(=O)O2)CC3=CC=CC=C3)C)C(=C1)OC(C)C(=O)O |
Computed by PubChem (NCBI)