Products 31752-99-5
CAS 31752-99-5 appears in our catalog under these names: (-)-Corey lactone 4-phenylbenzoate alcohol, 98%, (-)-Corey Lactone, (–)–Corey lactone, 4–phenylbenzoate alcohol, (-)-Corey lactone 4-phenylbenzoate, (-)-Corey Lactone 4-Phenylbenzoate, >98.0%(HPLC). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 2g, 0,005kg, 0,001kg.
[(3aR,4S,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (CAS 31752-99-5) is a chemical compound with the molecular formula C21H20O5 and a molecular weight of 352.4 g/mol. IUPAC name: [(3aR,4S,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate. InChIKey: SZJVIFMPKWMGSX-AKHDSKFASA-N.
| Molecular formula | C21H20O5 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | [(3aR,4S,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| InChIKey | SZJVIFMPKWMGSX-AKHDSKFASA-N |
| SMILES | C1[C@H]2[C@H](CC(=O)O2)[C@H]([C@@H]1OC(=O)C3=CC=C(C=C3)C4=CC=CC=C4)CO |
Computed by PubChem (NCBI)