CAS 159971-25-2 is the registry number for (E)-4-(2,5-Dimethylphenyl)-4-oxobut-2-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid (CAS 159971-25-2) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: (E)-4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid. InChIKey: YHCFVGCMSKTDFZ-AATRIKPKSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (E)-4-(2,5-dimethylphenyl)-4-oxobut-2-enoic acid |
| InChIKey | YHCFVGCMSKTDFZ-AATRIKPKSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)