CAS 152548-66-8 appears in our catalog under these names: Fmoc-n-me-asp(otbu)-oh, 97%, Fmoc–N–Me–Asp(OtBu)–OH, Fmoc-L-MeAsp(OtBu)-OH, Fmoc-N-Me-Asp(OtBu)-OH, Fmoc-N-Me-Asp(OtBu)-OH 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 1000mg, 2000mg, 5000mg.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 152548-66-8) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: CYWWLVIEAOUXGW-FQEVSTJZSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | CYWWLVIEAOUXGW-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)