Products 152567-81-2
CAS 152567-81-2 is the registry number for 2-(3-Fluoro-4-methoxybenzoyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(3-fluoro-4-methoxybenzoyl)benzoic acid (CAS 152567-81-2) is a chemical compound with the molecular formula C15H11FO4 and a molecular weight of 274.24 g/mol. IUPAC name: 2-(3-fluoro-4-methoxybenzoyl)benzoic acid. InChIKey: WEKIZZGUBCBQKN-UHFFFAOYSA-N.
| Molecular formula | C15H11FO4 |
|---|---|
| Molecular weight | 274.24 g/mol |
| IUPAC name | 2-(3-fluoro-4-methoxybenzoyl)benzoic acid |
| InChIKey | WEKIZZGUBCBQKN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O)F |
Computed by PubChem (NCBI)