CAS 152623-95-5 appears in our catalog under these names: 5–APDI (hydrochloride), 5-APDI (hydrochloride), alpha-Methyl-5-indanethylamine Hydrochloride,. Offered by: GLPBio, MedChemExpress, TRC. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 10 mg, 1 mg, 250mg.
1-(2,3-dihydro-1H-inden-5-yl)propan-2-amine;hydrochloride (CAS 152623-95-5) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 1-(2,3-dihydro-1H-inden-5-yl)propan-2-amine;hydrochloride. InChIKey: BYDGFBRMZHXMBV-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 1-(2,3-dihydro-1H-inden-5-yl)propan-2-amine;hydrochloride |
| InChIKey | BYDGFBRMZHXMBV-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=C(CCC2)C=C1)N.Cl |
Computed by PubChem (NCBI)