CAS 1526768-06-8 appears in our catalog under these names: Pantoprazole Impurity 49, Pantoprazole N-Methyl 6-Difluoromethoxy Thiol Impurity, Pantoprazole Impurity 41, Omeprazole Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
5-methoxy-3-methyl-1H-benzimidazole-2-thione (CAS 1526768-06-8) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 5-methoxy-3-methyl-1H-benzimidazole-2-thione. InChIKey: FLIWVGONXKPPML-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 5-methoxy-3-methyl-1H-benzimidazole-2-thione |
| InChIKey | FLIWVGONXKPPML-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)OC)NC1=S |
Computed by PubChem (NCBI)