Products 1526955-16-7

CAS 1526955-16-7 is the registry number for 4-(2-Azaspiro[3.3]heptan-2-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(2-azaspiro[3.3]heptan-2-yl)benzoic acid (CAS 1526955-16-7) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 4-(2-azaspiro[3.3]heptan-2-yl)benzoic acid. InChIKey: YYQXRTGBYZJVFC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO2
Molecular weight217.26 g/mol
IUPAC name4-(2-azaspiro[3.3]heptan-2-yl)benzoic acid
InChIKeyYYQXRTGBYZJVFC-UHFFFAOYSA-N
SMILESC1CC2(C1)CN(C2)C3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)