CAS 1527-96-4 appears in our catalog under these names: Crotonaldehyde 2,4-Dinitrophenylhydrazone, >95% (HPLC), Crotonaldehyde-2,4-dinitrophenylhydrazone, Crotonaldehyde-2,4-dinitrophenylhydrazone 100 µg/mL in Acetonitrile, Crotonaldehyde 2,4-Dinitrophenylhydrazone, >98.0%(HPLC)(T), CROTONALDEHYDE-DNPH, 1X1ML, 100UG/ML. Offered by: TRC, Dr. Ehrenstorfer, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 1g, 100mg, 1ml, 1EA, 250mg, 5g, 25g.
N-(but-2-enylideneamino)-2,4-dinitroaniline (CAS 1527-96-4) is a chemical compound with the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. IUPAC name: N-(but-2-enylideneamino)-2,4-dinitroaniline. InChIKey: GFUVNGJSSAEZHW-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O4 |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | N-(but-2-enylideneamino)-2,4-dinitroaniline |
| InChIKey | GFUVNGJSSAEZHW-UHFFFAOYSA-N |
| SMILES | CC=CC=NNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)