CAS 669757-38-4 appears in our catalog under these names: 1,2-Dimethyl-4-(4-nitrophenyl)-1,2,4-triazolidine-3,5-dione, 95%, 1,2-Dimethyl-4-(4-nitrophenyl)-1,2,4-triazolidine-3,5-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1,2-dimethyl-4-(4-nitrophenyl)-1,2,4-triazolidine-3,5-dione (CAS 669757-38-4) is a chemical compound with the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. IUPAC name: 1,2-dimethyl-4-(4-nitrophenyl)-1,2,4-triazolidine-3,5-dione. InChIKey: UZSFDHCVDQTTID-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O4 |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 1,2-dimethyl-4-(4-nitrophenyl)-1,2,4-triazolidine-3,5-dione |
| InChIKey | UZSFDHCVDQTTID-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C(=O)N1C)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)