CAS 31766-13-9 appears in our catalog under these names: Didanosine Impurity 5(Didanosine EP Impurity E), 2',3'-Anhydroinosine, >95% (HPLC), 2',3'-Anhydroinosine. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
9-[(1R,2R,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-1H-purin-6-one (CAS 31766-13-9) is a chemical compound with the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. IUPAC name: 9-[(1R,2R,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-1H-purin-6-one. InChIKey: WDIGUIIOGAEQHN-KQYNXXCUSA-N.
| Molecular formula | C10H10N4O4 |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 9-[(1R,2R,4R,5R)-4-(hydroxymethyl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-1H-purin-6-one |
| InChIKey | WDIGUIIOGAEQHN-KQYNXXCUSA-N |
| SMILES | C1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@H]4[C@H](O4)[C@H](O3)CO |
Computed by PubChem (NCBI)