Products 82593-40-6
CAS 82593-40-6 is the registry number for 6-Amino-1-(2-furanylmethyl)-3-methyl-5-nitroso-2,4(1H,3H)-pyrimidinedione. Offered by: TRC. Available pack sizes: 1g.
6-amino-1-(furan-2-ylmethyl)-3-methyl-5-nitrosopyrimidine-2,4-dione (CAS 82593-40-6) is a chemical compound with the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. IUPAC name: 6-amino-1-(furan-2-ylmethyl)-3-methyl-5-nitrosopyrimidine-2,4-dione. InChIKey: FEIXMBBQERXGDI-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O4 |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 6-amino-1-(furan-2-ylmethyl)-3-methyl-5-nitrosopyrimidine-2,4-dione |
| InChIKey | FEIXMBBQERXGDI-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(N(C1=O)CC2=CC=CO2)N)N=O |
Computed by PubChem (NCBI)