CAS 1527-98-6 appears in our catalog under these names: Butyraldehyde 2,4-Dinitrophenylhydrazone, >95% (HPLC), Butyraldehyde-2,4-dinitrophenylhydrazone, Butyraldehyde 2,4–Dinitrophenylhydrazone, Butyraldehyde 2,4-Dinitrophenylhydrazone, >98.0%(HPLC)(T), N-BUTYRALDEHYDE-DNPH, 1X1ML,1000UG/ML. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 10g, 1g, 100mg, 5g, 1EA, 250mg, 25g, 1x100mg.
N-(butylideneamino)-2,4-dinitroaniline (CAS 1527-98-6) is a chemical compound with the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. IUPAC name: N-(butylideneamino)-2,4-dinitroaniline. InChIKey: IKGRHEWIFBFXPP-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O4 |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | N-(butylideneamino)-2,4-dinitroaniline |
| InChIKey | IKGRHEWIFBFXPP-UHFFFAOYSA-N |
| SMILES | CCCC=NNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)