CAS 17781-08-7 is the registry number for 3-(1,3-Dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7h-purin-7-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid (CAS 17781-08-7) is a chemical compound with the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. IUPAC name: 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid. InChIKey: ZYUPLDFSBVJNIH-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O4 |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | 3-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanoic acid |
| InChIKey | ZYUPLDFSBVJNIH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCC(=O)O |
Computed by PubChem (NCBI)