Products 27231-68-1

CAS 27231-68-1 is the registry number for Doxofylline Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (CAS 27231-68-1) is a chemical compound with the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. IUPAC name: methyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate. InChIKey: OLVYPCHDIOWXLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N4O4
Molecular weight252.23 g/mol
IUPAC namemethyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate
InChIKeyOLVYPCHDIOWXLZ-UHFFFAOYSA-N
SMILESCN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(=O)OC

Computed by PubChem (NCBI)