CAS 27231-68-1 is the registry number for Doxofylline Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (CAS 27231-68-1) is a chemical compound with the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. IUPAC name: methyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate. InChIKey: OLVYPCHDIOWXLZ-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O4 |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | methyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| InChIKey | OLVYPCHDIOWXLZ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(=O)OC |
Computed by PubChem (NCBI)