Products 2633725-63-8

CAS 2633725-63-8 is the registry number for 3-(4-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)-1H-pyrazol-1-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[4-(2,4-dioxo-1,3-diazinan-1-yl)pyrazol-1-yl]propanoic acid (CAS 2633725-63-8) is a chemical compound with the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. IUPAC name: 3-[4-(2,4-dioxo-1,3-diazinan-1-yl)pyrazol-1-yl]propanoic acid. InChIKey: WAPJQICQZIEHPS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N4O4
Molecular weight252.23 g/mol
IUPAC name3-[4-(2,4-dioxo-1,3-diazinan-1-yl)pyrazol-1-yl]propanoic acid
InChIKeyWAPJQICQZIEHPS-UHFFFAOYSA-N
SMILESC1CN(C(=O)NC1=O)C2=CN(N=C2)CCC(=O)O

Computed by PubChem (NCBI)