CAS 2633725-63-8 is the registry number for 3-(4-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)-1H-pyrazol-1-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-(2,4-dioxo-1,3-diazinan-1-yl)pyrazol-1-yl]propanoic acid (CAS 2633725-63-8) is a chemical compound with the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. IUPAC name: 3-[4-(2,4-dioxo-1,3-diazinan-1-yl)pyrazol-1-yl]propanoic acid. InChIKey: WAPJQICQZIEHPS-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O4 |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | 3-[4-(2,4-dioxo-1,3-diazinan-1-yl)pyrazol-1-yl]propanoic acid |
| InChIKey | WAPJQICQZIEHPS-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CN(N=C2)CCC(=O)O |
Computed by PubChem (NCBI)