CAS 1530-12-7 appears in our catalog under these names: 9,9'-Bifluorene, 95%, 9,9'-Bifluorenyl, >98.0%(HPLC), 9H,9'H-9,9'-Bifluorene 95%, 9H,9'H-9,9'-bifluorene, 98%, 98%, 9H,9'H-9,9'-bifluorene, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 200mg.
9-(9H-fluoren-9-yl)-9H-fluorene (CAS 1530-12-7) is a chemical compound with the molecular formula C26H18 and a molecular weight of 330.4 g/mol. IUPAC name: 9-(9H-fluoren-9-yl)-9H-fluorene. InChIKey: QXAIDADUIMVTPS-UHFFFAOYSA-N.
| Molecular formula | C26H18 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 9-(9H-fluoren-9-yl)-9H-fluorene |
| InChIKey | QXAIDADUIMVTPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)C4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)