CAS 4709-68-6 is the registry number for Benzhydrylidenefluorene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
9-benzhydrylidenefluorene (CAS 4709-68-6) is a chemical compound with the molecular formula C26H18 and a molecular weight of 330.4 g/mol. IUPAC name: 9-benzhydrylidenefluorene. InChIKey: CGUOPWAERAISDV-UHFFFAOYSA-N.
| Molecular formula | C26H18 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 9-benzhydrylidenefluorene |
| InChIKey | CGUOPWAERAISDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C2C3=CC=CC=C3C4=CC=CC=C42)C5=CC=CC=C5 |
Computed by PubChem (NCBI)