CAS 849223-96-7 is the registry number for 9-([1,1'-Biphenyl]-2-yl)anthracene, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
9-(2-phenylphenyl)anthracene (CAS 849223-96-7) is a chemical compound with the molecular formula C26H18 and a molecular weight of 330.4 g/mol. IUPAC name: 9-(2-phenylphenyl)anthracene. InChIKey: VNDCOYDOXRMVON-UHFFFAOYSA-N.
| Molecular formula | C26H18 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 9-(2-phenylphenyl)anthracene |
| InChIKey | VNDCOYDOXRMVON-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=C4C=CC=CC4=CC5=CC=CC=C53 |
Computed by PubChem (NCBI)