CAS 21326-80-7 appears in our catalog under these names: 1,2–Di((1,1'–biphenyl)–4–yl)ethyne, 1,2-Di([1,1'-biphenyl]-4-yl)ethyne 98%, 1,2-Di([1,1'-biphenyl]-4-yl)ethyne, 98%, 98%, 1,1'-Biphenyl, 4,4''-(1,2-ethynediyl)bis-, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-phenyl-4-[2-(4-phenylphenyl)ethynyl]benzene (CAS 21326-80-7) is a chemical compound with the molecular formula C26H18 and a molecular weight of 330.4 g/mol. IUPAC name: 1-phenyl-4-[2-(4-phenylphenyl)ethynyl]benzene. InChIKey: NXWCDEUPFKTZSD-UHFFFAOYSA-N.
| Molecular formula | C26H18 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 1-phenyl-4-[2-(4-phenylphenyl)ethynyl]benzene |
| InChIKey | NXWCDEUPFKTZSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C#CC3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)