CAS 1530821-98-7 appears in our catalog under these names: 3-Amino-5-chloro-2-methoxy-N,N-dimethylbenzamide, 95%, 3-Amino-5-chloro-2-methoxy-N,N-dimethylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-amino-5-chloro-2-methoxy-N,N-dimethylbenzamide (CAS 1530821-98-7) is a chemical compound with the molecular formula C10H13ClN2O2 and a molecular weight of 228.67 g/mol. IUPAC name: 3-amino-5-chloro-2-methoxy-N,N-dimethylbenzamide. InChIKey: WOGSPEYOXNPBJA-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 3-amino-5-chloro-2-methoxy-N,N-dimethylbenzamide |
| InChIKey | WOGSPEYOXNPBJA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C(=CC(=C1)Cl)N)OC |
Computed by PubChem (NCBI)