Products 1531527-98-6
CAS 1531527-98-6 is the registry number for CRBN ligand-884. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(2,6-dioxopiperidin-3-yl)benzoic acid (CAS 1531527-98-6) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 4-(2,6-dioxopiperidin-3-yl)benzoic acid. InChIKey: GUHOLPHIFUCPDF-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 4-(2,6-dioxopiperidin-3-yl)benzoic acid |
| InChIKey | GUHOLPHIFUCPDF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)