CAS 1531545-30-8 is the registry number for 3-(3-Aminophenyl)-5-(methoxymethyl)imidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-aminophenyl)-5-(methoxymethyl)imidazolidine-2,4-dione (CAS 1531545-30-8) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: 3-(3-aminophenyl)-5-(methoxymethyl)imidazolidine-2,4-dione. InChIKey: ZWPLZHVXDZVGHZ-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 3-(3-aminophenyl)-5-(methoxymethyl)imidazolidine-2,4-dione |
| InChIKey | ZWPLZHVXDZVGHZ-UHFFFAOYSA-N |
| SMILES | COCC1C(=O)N(C(=O)N1)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)