Products 1531592-40-1
CAS 1531592-40-1 is the registry number for Lu AF58801. Offered by: MedChemExpress. Available pack sizes: Get quote.
Trans-(1S,2S)-N-[(1R)-1-(4-ethoxyphenyl)-2-hydroxyethyl]-2-phenylcyclopropane-1-carboxamide (CAS 1531592-40-1) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: trans-(1S,2S)-N-[(1R)-1-(4-ethoxyphenyl)-2-hydroxyethyl]-2-phenylcyclopropane-1-carboxamide. InChIKey: UIVKAFXVMUZVHS-QYZOEREBSA-N.
| Molecular formula | C20H23NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | trans-(1S,2S)-N-[(1R)-1-(4-ethoxyphenyl)-2-hydroxyethyl]-2-phenylcyclopropane-1-carboxamide |
| InChIKey | UIVKAFXVMUZVHS-QYZOEREBSA-N |
| SMILES | CCOC1=CC=C(C=C1)[C@H](CO)NC(=O)[C@H]2C[C@@H]2C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Lu AF58801, orb1701974