Products 1531769-14-8

CAS 1531769-14-8 is the registry number for 2-Hydroxy-3-(2,3,4-trimethoxyphenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-3-(2,3,4-trimethoxyphenyl)propanoic acid (CAS 1531769-14-8) is a chemical compound with the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. IUPAC name: 2-hydroxy-3-(2,3,4-trimethoxyphenyl)propanoic acid. InChIKey: JRWYCFNNGQYYOU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O6
Molecular weight256.25 g/mol
IUPAC name2-hydroxy-3-(2,3,4-trimethoxyphenyl)propanoic acid
InChIKeyJRWYCFNNGQYYOU-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)CC(C(=O)O)O)OC)OC

Computed by PubChem (NCBI)