CAS 1266359-89-0 is the registry number for Phenyl beta-D-glucopyranoside hydrate, 98%. Offered by: Thermo Scientific (Acros). Available pack sizes: 5g.
2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol (CAS 1266359-89-0) is a chemical compound with the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. IUPAC name: 2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol. InChIKey: NEZJDVYDSZTRFS-UHFFFAOYSA-N.
| Molecular formula | C12H16O6 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol |
| InChIKey | NEZJDVYDSZTRFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O |
Computed by PubChem (NCBI)