Products 15548-42-2
CAS 15548-42-2 is the registry number for 6-O-Benzyl D-Mannose. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 10000mg, 5000mg.
(2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol (CAS 15548-42-2) is a chemical compound with the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. IUPAC name: (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol. InChIKey: NEZJDVYDSZTRFS-LDMBFOFVSA-N.
| Molecular formula | C12H16O6 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol |
| InChIKey | NEZJDVYDSZTRFS-LDMBFOFVSA-N |
| SMILES | C1=CC=C(C=C1)O[C@H]2[C@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)