Products 62939-82-6
CAS 62939-82-6 is the registry number for Gama-Butyrolactone Related Compound 2. Offered by: Chemat Brand. Available pack sizes: on request.
[(3aR,4S,5R,6aS)-5-acetyloxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl acetate (CAS 62939-82-6) is a chemical compound with the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. IUPAC name: [(3aR,4S,5R,6aS)-5-acetyloxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl acetate. InChIKey: DOCCMIOGWPGCIS-CHWFTXMASA-N.
| Molecular formula | C12H16O6 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | [(3aR,4S,5R,6aS)-5-acetyloxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]methyl acetate |
| InChIKey | DOCCMIOGWPGCIS-CHWFTXMASA-N |
| SMILES | CC(=O)OC[C@H]1[C@@H](C[C@H]2[C@@H]1CC(=O)O2)OC(=O)C |
Computed by PubChem (NCBI)