Products 153186-26-6
CAS 153186-26-6 appears in our catalog under these names: 4’-a-C-Methyluridine, 4’-α-C-Methyluridine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg, Get quote.
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]pyrimidine-2,4-dione (CAS 153186-26-6) is a chemical compound with the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. IUPAC name: 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]pyrimidine-2,4-dione. InChIKey: ALQJCWREHBFHHQ-IBCQBUCCSA-N.
| Molecular formula | C10H14N2O6 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | ALQJCWREHBFHHQ-IBCQBUCCSA-N |
| SMILES | C[C@]1([C@H]([C@H]([C@@H](O1)N2C=CC(=O)NC2=O)O)O)CO |
Computed by PubChem (NCBI)