Products 153186-29-9
CAS 153186-29-9 appears in our catalog under these names: 4'-α-C-Methylcytidine, 4’-α-C-Methylcytidine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 2mg, 1mg, 5mg, 10mg, Get quote.
4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]pyrimidin-2-one (CAS 153186-29-9) is a chemical compound with the molecular formula C10H15N3O5 and a molecular weight of 257.24 g/mol. IUPAC name: 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]pyrimidin-2-one. InChIKey: MUBNRBNWTUDOEJ-IBCQBUCCSA-N.
| Molecular formula | C10H15N3O5 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]pyrimidin-2-one |
| InChIKey | MUBNRBNWTUDOEJ-IBCQBUCCSA-N |
| SMILES | C[C@]1([C@H]([C@H]([C@@H](O1)N2C=CC(=NC2=O)N)O)O)CO |
Computed by PubChem (NCBI)