Products 153304-75-7
CAS 153304-75-7 appears in our catalog under these names: Methyl 4-amino-3-ethylbenzoate, Methyl 4-amino-3-ethylbenzoate 95%, Methyl 4-amino-3-ethylbenzoate, 95%, 95%, Methyl 4-amino-3-ethylbenzoate, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g.
Methyl 4-amino-3-ethylbenzoate (CAS 153304-75-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 4-amino-3-ethylbenzoate. InChIKey: BUHJYJUFJWHZKI-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 4-amino-3-ethylbenzoate |
| InChIKey | BUHJYJUFJWHZKI-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)C(=O)OC)N |
Computed by PubChem (NCBI)