CAS 15336-81-9 appears in our catalog under these names: 5,5-Dimethyl-1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione, 90%, 5,5-Dimethyl-1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione, 90%, 90%, 5,5-DIMETHYL-1,3-BIS(OXIRANYLMETHYL)IMIDAZOLIDINE-2,4-DIONE, 90%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 50g, 100g, 200g, 500g.
5,5-dimethyl-1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione (CAS 15336-81-9) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: 5,5-dimethyl-1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione. InChIKey: RZJKZTPKSRPUFJ-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 5,5-dimethyl-1,3-bis(oxiran-2-ylmethyl)imidazolidine-2,4-dione |
| InChIKey | RZJKZTPKSRPUFJ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1CC2CO2)CC3CO3)C |
Computed by PubChem (NCBI)