CAS 903570-19-4 is the registry number for Methyl 5-((tert-butoxycarbonyl)amino)-1h-pyrrole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrrole-2-carboxylate (CAS 903570-19-4) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrrole-2-carboxylate. InChIKey: VFZSITZUGSWZQZ-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyrrole-2-carboxylate |
| InChIKey | VFZSITZUGSWZQZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(N1)C(=O)OC |
Computed by PubChem (NCBI)