CAS 870532-76-6 appears in our catalog under these names: 1-tert-Butyl 3-ethyl 1h-pyrazole-1,3-dicarboxylate, 95%, 1-tert-Butyl 3-ethyl 1H-pyrazole-1,3-dicarboxylate, 97%, 1-tert-Butyl 3-ethyl 1h-pyrazole-1,3-dicarboxylate, 97%, 97%, 1H-PYRAZOLE-1,3-DICARBOXYLIC ACID,1-(1,1-DIMETHYLETHYL)3-ETHYL ESTER, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-O-tert-butyl 3-O-ethyl pyrazole-1,3-dicarboxylate (CAS 870532-76-6) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl pyrazole-1,3-dicarboxylate. InChIKey: DDEUHMXKIWTWCX-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl pyrazole-1,3-dicarboxylate |
| InChIKey | DDEUHMXKIWTWCX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C=C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)