CAS 77716-11-1 appears in our catalog under these names: 4-tert-Butoxycarbonylamino-1-methyl-1h-pyrrole-2-carboxylic acid, 97%, 4-(Boc-amino)-1-methylpyrrole-2-carboxylic Acid, >95% (HPLC), Boc-Py-OH, 4-(Boc-amino)-1-methyl-1H-pyrrole-2-carboxylic Acid, >98.0%(HPLC)(T), 4-[(tert-Butoxycarbonyl)amino]-1-methyl-1H-pyrrole-2-carboxylic acid, 97% . Offered by: Combi-blocks, TRC, Iris Biotech, TCI, Thermo Scientific. Available pack sizes: 5g, 25g, 1g, 250mg, 100g, 100mg, 10g.
1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-2-carboxylic acid (CAS 77716-11-1) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: 1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-2-carboxylic acid. InChIKey: GOLAEMFBWAIGRX-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-2-carboxylic acid |
| InChIKey | GOLAEMFBWAIGRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN(C(=C1)C(=O)O)C |
Computed by PubChem (NCBI)