Products 15341-58-9
CAS 15341-58-9 is the registry number for (E)-3-(5-Nitrofuran-2-yl)acrylic acid, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(E)-3-(5-nitrofuran-2-yl)prop-2-enoic acid (CAS 15341-58-9) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: (E)-3-(5-nitrofuran-2-yl)prop-2-enoic acid. InChIKey: LWOWNIPZHGWKNR-DUXPYHPUSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | (E)-3-(5-nitrofuran-2-yl)prop-2-enoic acid |
| InChIKey | LWOWNIPZHGWKNR-DUXPYHPUSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(5-Nitro-2-furyl)acrylic acid, 5-Nitro-2-furanacrylic acid, Nitrofurylacrylic acid, 2-Propenoic acid, 3-(5-nitro-2-furanyl)-, 5-nitro-2-furylacrylic acid, 3-(5-Nitro-2-furanyl)-2-propenoic acid, 3-(5-Nitrofuran-2-yl)acrylic acid, (2E)-3-(5-nitrofuran-2-yl)prop-2-enoic acid, 5-Nitrofurylacrylic acid, trans-5-nitro-2-furanacrylic acid