CAS 153501-30-5 appears in our catalog under these names: 5–Bromo–3–hydroxy–1H–indole–2–carboxylic acid ethyl ester, 5-Bromo-3-hydroxy-1H-indole-2-carboxylic acid ethyl ester, 95%, 95%, 5-Bromo-3-hydroxy-1H-indole-2-carboxylic acid ethyl ester, 98%, 5-Bromo-3-hydroxy-1H-indole-2-carboxylic acid ethyl ester, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 5-bromo-3-hydroxy-1H-indole-2-carboxylate (CAS 153501-30-5) is a chemical compound with the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. IUPAC name: ethyl 5-bromo-3-hydroxy-1H-indole-2-carboxylate. InChIKey: YULOKRNQEYIONX-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO3 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | ethyl 5-bromo-3-hydroxy-1H-indole-2-carboxylate |
| InChIKey | YULOKRNQEYIONX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)C=CC(=C2)Br)O |
Computed by PubChem (NCBI)