Products 153501-38-3
CAS 153501-38-3 is the registry number for Ethyl 3-hydroxy-4-methyl-1H-indole-2-carboxylate, 98%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ethyl 3-hydroxy-4-methyl-1H-indole-2-carboxylate (CAS 153501-38-3) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: ethyl 3-hydroxy-4-methyl-1H-indole-2-carboxylate. InChIKey: WXNNDCUHYBVEKV-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | ethyl 3-hydroxy-4-methyl-1H-indole-2-carboxylate |
| InChIKey | WXNNDCUHYBVEKV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=CC=C2N1)C)O |
Computed by PubChem (NCBI)