CAS 153575-98-5 appears in our catalog under these names: N-(Methoxycarbonyl)-D-valine methyl ester, 98%, 98%, N-(Methoxycarbonyl)-D-valine methyl ester, 98%, N-(Methoxycarbonyl)-D-valine methyl ester, 95%, N–(Methoxycarbonyl)–D–valine methyl ester, N-(Methoxycarbonyl)-D-valine methyl ester, 98.01%. Offered by: Chemat, Fluorochem, AmBeed, GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 100 mg, 250 mg, 1 g.
Methyl (2R)-2-(methoxycarbonylamino)-3-methylbutanoate (CAS 153575-98-5) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: methyl (2R)-2-(methoxycarbonylamino)-3-methylbutanoate. InChIKey: QWGFBSMKDNXREL-ZCFIWIBFSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | methyl (2R)-2-(methoxycarbonylamino)-3-methylbutanoate |
| InChIKey | QWGFBSMKDNXREL-ZCFIWIBFSA-N |
| SMILES | CC(C)[C@H](C(=O)OC)NC(=O)OC |
Computed by PubChem (NCBI)