CAS 1535978-10-9 appears in our catalog under these names: 2-(2-Aminophenyl)-1,1,1-trifluoropropan-2-ol, 98%, 2-(2-Aminophenyl)-1,1,1-trifluoro-2-propanol, ≥95%, ≥95%, 2-(2-AMINOPHENYL)-1,1,1-TRIFLUORO-2-PROPANOL, ≥95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-(2-aminophenyl)-1,1,1-trifluoropropan-2-ol (CAS 1535978-10-9) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: 2-(2-aminophenyl)-1,1,1-trifluoropropan-2-ol. InChIKey: FKLQOZHJXLWQBQ-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 2-(2-aminophenyl)-1,1,1-trifluoropropan-2-ol |
| InChIKey | FKLQOZHJXLWQBQ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1N)(C(F)(F)F)O |
Computed by PubChem (NCBI)