Products 153602-71-2
CAS 153602-71-2 is the registry number for Dimethyl 1H-indole-5,6-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Dimethyl 1H-indole-5,6-dicarboxylate (CAS 153602-71-2) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: dimethyl 1H-indole-5,6-dicarboxylate. InChIKey: AZBWCKJMPVACOQ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | dimethyl 1H-indole-5,6-dicarboxylate |
| InChIKey | AZBWCKJMPVACOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C2C(=C1)C=CN2)C(=O)OC |
Computed by PubChem (NCBI)