Products 153610-50-5
CAS 153610-50-5 appears in our catalog under these names: trans-Stilbene-alpha,beta-13C2, 99 atom % 13C, min 98% Chemical Purity, trans-Stilbene-13C2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 1 mg.
[(E)-2-phenyl(1,2-13C2)ethenyl]benzene (CAS 153610-50-5) is a chemical compound with the molecular formula C14H12 and a molecular weight of 182.23 g/mol. IUPAC name: [(E)-2-phenyl(1,2-13C2)ethenyl]benzene. InChIKey: PJANXHGTPQOBST-TYBRUWTQSA-N.
| Molecular formula | C14H12 |
|---|---|
| Molecular weight | 182.23 g/mol |
| IUPAC name | [(E)-2-phenyl(1,2-13C2)ethenyl]benzene |
| InChIKey | PJANXHGTPQOBST-TYBRUWTQSA-N |
| SMILES | C1=CC=C(C=C1)/[13CH]=[13CH]/C2=CC=CC=C2 |
Computed by PubChem (NCBI)