Products 20748-24-7
CAS 20748-24-7 appears in our catalog under these names: trans-Stilbene-d10 (rings-d10), 98 atom % D, min 98% Chemical Purity, trans-Stilbene-d10. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1,2,3,4,5-pentadeuterio-6-[(E)-2-(2,3,4,5,6-pentadeuteriophenyl)ethenyl]benzene (CAS 20748-24-7) is a chemical compound with the molecular formula C14H12 and a molecular weight of 190.31 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-[(E)-2-(2,3,4,5,6-pentadeuteriophenyl)ethenyl]benzene. InChIKey: PJANXHGTPQOBST-FHJPSXJRSA-N.
| Molecular formula | C14H12 |
|---|---|
| Molecular weight | 190.31 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-[(E)-2-(2,3,4,5,6-pentadeuteriophenyl)ethenyl]benzene |
| InChIKey | PJANXHGTPQOBST-FHJPSXJRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C=C/C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)