Products 5284-44-6
CAS 5284-44-6 appears in our catalog under these names: trans-Stilbene-alpha,alpha'-d2, 98 atom % D, min 98% Chemical Purity, trans-Stilbene-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10 mg, 5 mg, 25 mg, 100 mg, 50 mg.
[(E)-1,2-dideuterio-2-phenylethenyl]benzene (CAS 5284-44-6) is a chemical compound with the molecular formula C14H12 and a molecular weight of 182.26 g/mol. IUPAC name: [(E)-1,2-dideuterio-2-phenylethenyl]benzene. InChIKey: PJANXHGTPQOBST-JGAOXNKASA-N.
| Molecular formula | C14H12 |
|---|---|
| Molecular weight | 182.26 g/mol |
| IUPAC name | [(E)-1,2-dideuterio-2-phenylethenyl]benzene |
| InChIKey | PJANXHGTPQOBST-JGAOXNKASA-N |
| SMILES | [2H]/C(=C(/[2H])\C1=CC=CC=C1)/C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
trans-Stilbene-d2, orb3138321